קובץ:1-chloropyrrolidine-2,5-dione 200.svg
קפיצה לניווט
קפיצה לחיפוש
גודל התצוגה המקדימה הזאת מסוג PNG של קובץ ה־SVG הזה: 120 × 85 פיקסלים. רזולוציות אחרות: 320 × 227 פיקסלים | 640 × 453 פיקסלים | 1,024 × 725 פיקסלים | 1,280 × 907 פיקסלים | 2,560 × 1,813 פיקסלים.
לקובץ המקורי (קובץ SVG, הגודל המקורי: 120 × 85 פיקסלים, גודל הקובץ: 4 ק"ב)
תקציר
| תיאור |
English: Structure of 1-chloropyrrolidine-2,5-dione |
| תאריך יצירה | |
| מקור | נוצר על־ידי מעלה היצירה |
| יוצר | Emeldir (שיחה) |
| SVGהתפתחות |
|
The accuracy of this version of the structural formula has been verified as part of the Chemical Structure Validation project. International Chemical Identifier: InChI=1S/C4H4ClNO2/c5-6-3(7)1-2-4(6)8/h1-2H2 InChI key: JRNVZBWKYDBUCA-UHFFFAOYSA-N CAS registry number: 128-09-6 EC number: 204-878-8
|
Synonyms
1-Chloro-2,5-pyrrolidinedione 1-Chloropyrrolidine-2,5-dione 1-chloropyrrolidine-2,5-dione 2,5-Pyrrolidinedione, 1-chloro- 2,5-Pyrrolidinedione, 1-chloro- (9CI) Chlorosuccinimide N-Chlorosuccinimide N-Chlorosuccinimide(N-chlorobutanimide) NCS Pyrrolidinedione, 1-chloro- Succinchlorimide Succinic N-chloroimide Succinimide, N-chloro- (8CI) Succinochlorimide WLN: T5VNVTJ BG
רישיון
|
יצירה זו של נוסחת מבנה היא נטולת זכויות יוצרים ומשום כך היא ברשות הציבור. היצירה מורכבת כולה, מיֶדַע שהוא נחלת הכלל, ואין לה מרכיב יצירתי מקורי.
|
 |
היסטוריית הקובץ
ניתן ללחוץ על תאריך/שעה כדי לראות את הקובץ כפי שנראה באותו זמן.
| תאריך/שעה | תמונה ממוזערת | ממדים | משתמש | הערה | |
|---|---|---|---|---|---|
| נוכחית | 09:35, 8 במאי 2014 | | 85 × 120 (4 ק"ב) | wikimediacommons>Emeldir | {{Information |Description={{en|Structure of 1-chloropyrrolidine-2,5-dione}} |Source={{Own}} |Date={{subst:CURRENTYEAR}}-{{subst:CURRENTMONTH}}-{{subst:CURRENTDAY2}} |Author=~~~ |Other_versions= }} {{Chemical structure verified |version= |InChI=1S/C4H... |
שימוש בקובץ
הדף הבא משתמש בקובץ הזה:
